17609-48-2 H-D-Phg-OEt . HCl
상품명칭 |
H-D-Phg-OEt . HCl |
영문 이름 |
H-D-Phg-OEt . HCl; D-(-)-alpha-Phenylglycine ethyl ester hydrochloride; (R)-(-)-alpha-Aminophenylacetic acid ethyl ester hydrochloride~H-D-Phg-OEt.HCl; ethyl (2-aminophenyl)acetate hydrochloride; ethyl (2R)-amino(phenyl)ethanoate |
분자식 |
C10H13NO2 |
분자량 |
179.2157 |
InChI |
InChI=1/C10H13NO2/c1-2-13-10(12)9(11)8-6-4-3-5-7-8/h3-7,9H,2,11H2,1H3/t9-/m1/s1 |
cas번호 |
17609-48-2 |
EC번호 |
241-581-2 |
분자 구조 |
|
밀도 |
1.098g/cm3 |
비등점 |
257°C at 760 mmHg |
굴절 지수 |
1.529 |
인화점 |
120°C |
증기압 |
0.0149mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|