ChemNet > CAS > 17740-40-8 diethyl 1-benzylpyrrolidine-2,5-dicarboxylate
17740-40-8 diethyl 1-benzylpyrrolidine-2,5-dicarboxylate
| 상품명칭 |
diethyl 1-benzylpyrrolidine-2,5-dicarboxylate |
| 영문 이름 |
diethyl 1-benzylpyrrolidine-2,5-dicarboxylate; |
| 분자식 |
C17H23NO4 |
| 분자량 |
305.3688 |
| InChI |
InChI=1/C17H23NO4/c1-3-21-16(19)14-10-11-15(17(20)22-4-2)18(14)12-13-8-6-5-7-9-13/h5-9,14-15H,3-4,10-12H2,1-2H3 |
| cas번호 |
17740-40-8 |
| 분자 구조 |
|
| 밀도 |
1.146g/cm3 |
| 비등점 |
381.3°C at 760 mmHg |
| 굴절 지수 |
1.53 |
| 인화점 |
184.4°C |
| 증기압 |
5.14E-06mmHg at 25°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
