ChemNet > CAS > 177756-62-6 3-Fluoro-4-methylbenzaldehyde
177756-62-6 3-Fluoro-4-methylbenzaldehyde
상품명칭 |
3-Fluoro-4-methylbenzaldehyde |
영문 이름 |
3-Fluoro-4-methylbenzaldehyde; 3-Fluoro-p-tolualdehyde |
분자식 |
C8H7FO |
분자량 |
138.139 |
InChI |
InChI=1/C8H7FO/c1-6-2-3-7(5-10)4-8(6)9/h2-5H,1H3 |
cas번호 |
177756-62-6 |
분자 구조 |
|
밀도 |
1.136g/cm3 |
비등점 |
198.3°C at 760 mmHg |
굴절 지수 |
1.534 |
인화점 |
80.1°C |
증기압 |
0.362mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|