ChemNet > CAS > 178305-99-2 2-Fluorobiphenyl-4-boronic acid
178305-99-2 2-Fluorobiphenyl-4-boronic acid
상품명칭 |
2-Fluorobiphenyl-4-boronic acid |
영문 이름 |
2-Fluorobiphenyl-4-boronic acid; 3-Fluoro-4-phenylbenzeneboronic acid; 2-Fluoro-4-biphenylylboronic acid; (2-fluorobiphenyl-4-yl)boronic acid; (3-fluorobiphenyl-4-yl)boronic acid |
분자식 |
C12H10BFO2 |
분자량 |
216.016 |
InChI |
InChI=1/C12H10BFO2/c14-12-8-10(6-7-11(12)13(15)16)9-4-2-1-3-5-9/h1-8,15-16H |
cas번호 |
178305-99-2 |
분자 구조 |
|
밀도 |
1.257g/cm3 |
녹는 점 |
243-248℃ |
비등점 |
384.155°C at 760 mmHg |
굴절 지수 |
1.591 |
인화점 |
186.131°C |
증기압 |
0mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S22:;
S24/25:;
|
|