1785-61-1 m-Diethynylbenzene
상품명칭 |
m-Diethynylbenzene |
영문 이름 |
m-Diethynylbenzene; 1,3-Diethynylbenzene |
분자식 |
C10H6 |
분자량 |
126.1546 |
InChI |
InChI=1/C10H6/c1-3-9-6-5-7-10(4-2)8-9/h1-2,5-8H |
cas번호 |
1785-61-1 |
분자 구조 |
|
밀도 |
1g/cm3 |
비등점 |
206.9°C at 760 mmHg |
굴절 지수 |
1.567 |
인화점 |
66.5°C |
증기압 |
0.332mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|