ChemNet > CAS > 17969-22-1 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole
17969-22-1 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole
| 상품명칭 |
4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole |
| 영문 이름 |
4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole; |
| 분자식 |
C10H7Cl2NS |
| 분자량 |
244.1403 |
| InChI |
InChI=1/C10H7Cl2NS/c11-5-9-6-14-10(13-9)7-1-3-8(12)4-2-7/h1-4,6H,5H2 |
| cas번호 |
17969-22-1 |
| 분자 구조 |
|
| 밀도 |
1.378g/cm3 |
| 녹는 점 |
78℃ |
| 비등점 |
374°C at 760 mmHg |
| 굴절 지수 |
1.617 |
| 인화점 |
180°C |
| 증기압 |
1.85E-05mmHg at 25°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
