ChemNet > CAS > 180-84-7 1,7-Dioxaspiro(5.5)undecane
180-84-7 1,7-Dioxaspiro(5.5)undecane
상품명칭 |
1,7-Dioxaspiro(5.5)undecane |
영문 이름 |
1,7-Dioxaspiro(5.5)undecane; Dioxaspiroundecane |
분자식 |
C9H16O2 |
분자량 |
156.2221 |
InChI |
InChI=1/C9H16O2/c1-3-7-10-9(5-1)6-2-4-8-11-9/h1-8H2 |
cas번호 |
180-84-7 |
EC번호 |
205-870-7 |
분자 구조 |
|
밀도 |
1.02g/cm3 |
비등점 |
193.5°C at 760 mmHg |
굴절 지수 |
1.475 |
인화점 |
63.9°C |
증기압 |
0.645mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|