1817-47-6 4-Isopropylnitrobenzene
상품명칭 |
4-Isopropylnitrobenzene |
영문 이름 |
4-Isopropylnitrobenzene; 4-Isopropylnitrobenzene~4-Nitrocumene; 1-(1-methylethyl)-4-nitro-benzene; 4-Nitrocumene; 1-Isopropyl-4-Nitrobenzene; 4-Nitro-Isopropylbenzene; 1-nitro-4-(propan-2-yl)benzene |
분자식 |
C9H11NO2 |
분자량 |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7H,1-2H3 |
cas번호 |
1817-47-6 |
EC번호 |
217-326-6 |
분자 구조 |
|
밀도 |
1.091g/cm3 |
비등점 |
236.4°C at 760 mmHg |
굴절 지수 |
1.533 |
인화점 |
99.9°C |
증기압 |
0.0728mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|