ChemNet > CAS > 182482-25-3 2,4,6-Trifluorobenzeneboronic acid
182482-25-3 2,4,6-Trifluorobenzeneboronic acid
상품명칭 |
2,4,6-Trifluorobenzeneboronic acid |
영문 이름 |
2,4,6-Trifluorobenzeneboronic acid; 2,4,6-Trifluorophenylboronicacid; 2,4,6-Trifluorophenylboronic acid |
분자식 |
C6H4BF3O2 |
분자량 |
175.901 |
InChI |
InChI=1/C6H4BF3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,11-12H |
cas번호 |
182482-25-3 |
분자 구조 |
|
밀도 |
1.44g/cm3 |
녹는 점 |
228-235℃ |
비등점 |
266°C at 760 mmHg |
굴절 지수 |
1.465 |
인화점 |
114.6°C |
증기압 |
0.00444mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|