ChemNet > CAS > 18355-80-1 2,3-difluoroacetophenone
18355-80-1 2,3-difluoroacetophenone
| 상품명칭 |
2,3-difluoroacetophenone |
| 영문 이름 |
2,3-difluoroacetophenone; 2',3'-difluoroacetophenone; 1-(2,3-difluorophenyl)ethanone |
| 분자식 |
C8H6F2O |
| 분자량 |
156.1294 |
| InChI |
InChI=1/C8H6F2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
| cas번호 |
18355-80-1 |
| 분자 구조 |
|
| 밀도 |
1.206g/cm3 |
| 비등점 |
193.4°C at 760 mmHg |
| 굴절 지수 |
1.472 |
| 인화점 |
71.5°C |
| 증기압 |
0.465mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
