ChemNet > CAS > 18362-64-6 2,6-Dimethyl-3,5-heptanedione
18362-64-6 2,6-Dimethyl-3,5-heptanedione
상품명칭 |
2,6-Dimethyl-3,5-heptanedione |
영문 이름 |
2,6-Dimethyl-3,5-heptanedione;2,6-dimethylheptane-3,5-dione; (4Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one |
분자식 |
C9H16O2 |
분자량 |
156.2221 |
InChI |
InChI=1/C9H16O2/c1-6(2)8(10)5-9(11)7(3)4/h5-7,10H,1-4H3/b8-5- |
cas번호 |
18362-64-6 |
EC번호 |
242-234-8 |
분자 구조 |
|
밀도 |
0.941g/cm3 |
비등점 |
239.2°C at 760 mmHg |
굴절 지수 |
1.456 |
인화점 |
97.8°C |
증기압 |
0.00713mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|