ChemNet > CAS > 18591-82-7 6-Methylpyridazin-3-amine
18591-82-7 6-Methylpyridazin-3-amine
상품명칭 |
6-Methylpyridazin-3-amine |
영문 이름 |
6-Methylpyridazin-3-amine; 3-Amino-6-Methylpyridazine |
분자식 |
C5H7N3 |
분자량 |
109.13068 |
InChI |
InChI=1/C4H4IN3/c5-3-1-2-4(6)8-7-3/h1-2H,(H2,6,8) |
cas번호 |
18591-82-7 |
EC번호 |
242-430-3 |
분자 구조 |
|
밀도 |
2.204g/cm3 |
녹는 점 |
230℃ |
비등점 |
399.6°C at 760 mmHg |
굴절 지수 |
1.719 |
인화점 |
195.5°C |
증기압 |
1.35E-06mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|