ChemNet > CAS > 186590-26-1 5-Bromo-2,3-difluorophenol
186590-26-1 5-Bromo-2,3-difluorophenol
상품명칭 |
5-Bromo-2,3-difluorophenol |
영문 이름 |
5-Bromo-2,3-difluorophenol; Bromodifluorophenol5; 3-Bromo-5,6-difluorophenol; 2,3-difluoro-5-bromophenol; bis[3-(trifluoromethyl)phenyl]methanone |
분자식 |
C6H3BrF2O |
분자량 |
208.9882 |
InChI |
InChI=1/C6H3BrF2O/c7-3-1-4(8)6(9)5(10)2-3/h1-2,10H |
cas번호 |
186590-26-1 |
분자 구조 |
|
밀도 |
1.858g/cm3 |
비등점 |
212.2°C at 760 mmHg |
굴절 지수 |
1.549 |
인화점 |
82.1°C |
증기압 |
0.121mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|