1871-67-6 2-Octenoic acid
상품명칭 |
2-Octenoic acid |
영문 이름 |
2-Octenoic acid; Octenoicacidpract; 2-Octenoic acid,predominantly trans; trans-2-Octenoic acid; oct-2-enoate |
분자식 |
C8H13O2 |
분자량 |
141.1882 |
InChI |
InChI=1/C8H14O2/c1-2-3-4-5-6-7-8(9)10/h6-7H,2-5H2,1H3,(H,9,10)/p-1 |
cas번호 |
1871-67-6 |
EC번호 |
217-491-4 |
분자 구조 |
|
녹는 점 |
5-6℃ |
비등점 |
260.2°C at 760 mmHg |
인화점 |
151.1°C |
증기압 |
0.0037mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|