18719-43-2 diethyl (3-chloropropyl)malonate

상품명칭	diethyl (3-chloropropyl)malonate
영문 이름	diethyl (3-chloropropyl)malonate; (3-Chloropropyl)malonic acid diethyl ester; diethyl (3-chloropropyl)propanedioate
분자식	C₁₀H₁₇ClO₄
분자량	236.6926
InChI	InChI=1/C10H17ClO4/c1-3-14-9(12)8(6-5-7-11)10(13)15-4-2/h8H,3-7H2,1-2H3
cas번호	18719-43-2
분자 구조
밀도	1.114g/cm³
비등점	290.2°C at 760 mmHg
굴절 지수	1.447
인화점	111.9°C
증기압	0.0021mmHg at 25°C
위험성 표시
리스크 규칙	R36/38:Irritating to eyes and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;