ChemNet > CAS > 1875-89-4 3-Methylphenethyl alcohol
1875-89-4 3-Methylphenethyl alcohol
상품명칭 |
3-Methylphenethyl alcohol |
영문 이름 |
3-Methylphenethyl alcohol; 2-m-tolylethanol; 2-(3-Methylphenyl)ethanol; 2-(4-methylphenyl)ethanol; M-METHYL PHENYL ETHANOL; m-Methylphenethyl alcohol |
분자식 |
C9H12O |
분자량 |
136.191 |
InChI |
InChI=1/C9H12O/c1-8-2-4-9(5-3-8)6-7-10/h2-5,10H,6-7H2,1H3 |
cas번호 |
1875-89-4 |
EC번호 |
217-508-5 |
분자 구조 |
|
밀도 |
1.001g/cm3 |
비등점 |
243.5°C at 760 mmHg |
굴절 지수 |
1.532 |
인화점 |
107.2°C |
증기압 |
0.0172mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|