ChemNet > CAS > 187657-92-7 1-(1-benzofuran-3-yl)-2-bromo-1-ethanone
187657-92-7 1-(1-benzofuran-3-yl)-2-bromo-1-ethanone
| 상품명칭 |
1-(1-benzofuran-3-yl)-2-bromo-1-ethanone |
| 영문 이름 |
1-(1-benzofuran-3-yl)-2-bromo-1-ethanone;[2,4-bis(methylsulfonyl)phenyl]hydrazine; 1-(1-benzofuran-3-yl)-2-bromoethanone |
| 분자식 |
C10H7BrO2 |
| 분자량 |
239.0654 |
| InChI |
InChI=1/C10H7BrO2/c11-5-9(12)8-6-13-10-4-2-1-3-7(8)10/h1-4,6H,5H2 |
| cas번호 |
187657-92-7 |
| EC번호 |
260-718-7 |
| 분자 구조 |
|
| 밀도 |
1.582g/cm3 |
| 녹는 점 |
136℃ |
| 비등점 |
306.8°C at 760 mmHg |
| 굴절 지수 |
1.636 |
| 인화점 |
139.3°C |
| 증기압 |
0.000755mmHg at 25°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
