ChemNet > CAS > 1877-73-2 3-Nitrophenylacetic acid
1877-73-2 3-Nitrophenylacetic acid
| 상품명칭 |
3-Nitrophenylacetic acid |
| 영문 이름 |
3-Nitrophenylacetic acid; (3-nitrophenyl)acetic acid; (3-nitrophenyl)acetate; m-Nitrophenylacetic acid; (3-nitrophenyl) acetic acid |
| 분자식 |
C8H6NO4 |
| 분자량 |
180.1381 |
| InChI |
InChI=1/C8H7NO4/c10-8(11)5-6-2-1-3-7(4-6)9(12)13/h1-4H,5H2,(H,10,11)/p-1 |
| cas번호 |
1877-73-2 |
| EC번호 |
217-512-7 |
| 분자 구조 |
|
| 녹는 점 |
116-120℃ |
| 비등점 |
373.8°C at 760 mmHg |
| 인화점 |
169.8°C |
| 증기압 |
2.98E-06mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
