ChemNet > CAS > 18927-05-4 Methyl 3-methoxyphenylacetate
18927-05-4 Methyl 3-methoxyphenylacetate
상품명칭 |
Methyl 3-methoxyphenylacetate |
영문 이름 |
Methyl 3-methoxyphenylacetate; Methyl 2-(3-methoxyphenyl)acetate |
분자식 |
C10H12O3 |
분자량 |
180.2005 |
InChI |
InChI=1/C10H12O3/c1-12-9-5-3-4-8(6-9)7-10(11)13-2/h3-6H,7H2,1-2H3 |
cas번호 |
18927-05-4 |
분자 구조 |
|
밀도 |
1.083g/cm3 |
비등점 |
254°C at 760 mmHg |
굴절 지수 |
1.499 |
인화점 |
100.2°C |
증기압 |
0.0176mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|