18937-79-6 Methyl 2-hexynoate
상품명칭 |
Methyl 2-hexynoate |
영문 이름 |
Methyl 2-hexynoate; 2-Hexynoic acid methyl ester; methyl hex-2-ynoate |
분자식 |
C7H10O2 |
분자량 |
126.1531 |
InChI |
InChI=1/C7H10O2/c1-3-4-5-6-7(8)9-2/h3-4H2,1-2H3 |
cas번호 |
18937-79-6 |
EC번호 |
242-690-8 |
분자 구조 |
|
밀도 |
0.963g/cm3 |
비등점 |
184.4°C at 760 mmHg |
굴절 지수 |
1.436 |
인화점 |
65.4°C |
증기압 |
0.734mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|