상품명칭 |
2,2-Diphenyl-1-picrylhydrazyl |
영문 이름 |
2,2-Diphenyl-1-picrylhydrazyl; 1,1-Diphenyl-2-picrylhydrazyl (free radical); 2,2-Diphenyl-1-(2,4,6-trinitrophenyl)hydrazyl; 4-15-00-01210 (Beilstein Handbook Reference); AI3-61739; BRN 1846081; Diphenylpicrylhydrazyl free radical; N,N-Diphenyl-N'-picrylhydrazyl; NSC 12562; Hydrazinyl, 2,2-diphenyl-1-(2,4,6-trinitrophenyl)-; Hydrazyl, 2,2-diphenyl-1-(2,4,6-trinitrophenyl)-; Hydrazyl, 2,2-diphenyl-1-picryl- (8CI); 1,1-diphenyl-2-(2,4,6-trinitrophenyl)diazenium; 2,2-diphenyl-1-(2,4,6-trinitrophenyl)hydrazinyl; DPPH |
분자식 |
C18H12N5O6 |
분자량 |
394.3178 |
InChI |
InChI=1/C18H12N5O6/c24-21(25)15-11-16(22(26)27)18(17(12-15)23(28)29)19-20(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H |
cas번호 |
1898-66-4 |
EC번호 |
217-591-8 |
분자 구조 |
|
녹는 점 |
136-138℃ |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|