ChemNet > CAS > 189807-20-3 2,3,6-trifluorobenzoyl chloride
189807-20-3 2,3,6-trifluorobenzoyl chloride
상품명칭 |
2,3,6-trifluorobenzoyl chloride |
영문 이름 |
2,3,6-trifluorobenzoyl chloride; Trifluorobenzoylchloride |
분자식 |
C7H2ClF3O |
분자량 |
194.5384 |
InChI |
InChI=1/C7H2ClF3O/c8-7(12)5-3(9)1-2-4(10)6(5)11/h1-2H |
cas번호 |
189807-20-3 |
분자 구조 |
|
밀도 |
1.514g/cm3 |
비등점 |
180.1°C at 760 mmHg |
굴절 지수 |
1.479 |
인화점 |
59°C |
증기압 |
0.913mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|