1899-48-5 2,4-Diaminoquinazoline
상품명칭 |
2,4-Diaminoquinazoline |
영문 이름 |
2,4-Diaminoquinazoline;NSC 403373; 2,4-Quinazolinediamine; quinazoline-2,4-diamine |
분자식 |
C8H8N4 |
분자량 |
160.1759 |
InChI |
InChI=1/C8H8N4/c9-7-5-3-1-2-4-6(5)11-8(10)12-7/h1-4H,(H4,9,10,11,12) |
cas번호 |
1899-48-5 |
분자 구조 |
|
밀도 |
1.398g/cm3 |
비등점 |
461°C at 760 mmHg |
굴절 지수 |
1.795 |
인화점 |
263.5°C |
증기압 |
1.11E-08mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|