1921-70-6 2,6,10,14-Tetramethylpentadecane

상품명칭	2,6,10,14-Tetramethylpentadecane
영문 이름	2,6,10,14-Tetramethylpentadecane;
분자식	C₁₉H₄₀
분자량	268.5209
InChI	InChI=1/C19H40/c1-16(2)10-7-12-18(5)14-9-15-19(6)13-8-11-17(3)4/h16-19H,7-15H2,1-6H3
cas번호	1921-70-6
EC번호	217-650-8
분자 구조
밀도	0.781g/cm³
비등점	296°C at 760 mmHg
굴절 지수	1.436
인화점	140.7°C
증기압	0.0026mmHg at 25°C
위험성 표시	Xi:Irritant;
리스크 규칙	R36/38:Irritating to eyes and skin.;
보안 규칙	S24/25:Avoid contact with skin and eyes.;