19234-20-9 (2-이소프로폭시에틸) 아세테이트
상품명칭 |
(2-이소프로폭시에틸) 아세테이트 |
별명 |
;이소프로필글리콜 아세테이트; 에틸렌글리콜 모노이소프로필 에테르 아세테이트; 2-(프로판-2-일옥시)에틸 아세테이트 |
영문 이름 |
(2-Isopropoxyethyl) acetate; Isopropylglycol acetate; Ethyleneglycol monoisopropyl ether acetate; 2-(propan-2-yloxy)ethyl acetate |
분자식 |
C7H14O3 |
분자량 |
146.1843 |
InChI |
InChI=1/C7H14O3/c1-6(2)9-4-5-10-7(3)8/h6H,4-5H2,1-3H3 |
cas번호 |
19234-20-9 |
EC번호 |
242-901-3 |
분자 구조 |
|
밀도 |
0.947g/cm3 |
비등점 |
177.6°C at 760 mmHg |
굴절 지수 |
1.406 |
인화점 |
56.8°C |
증기압 |
1.03mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|