ChemNet > CAS > 19312-06-2 4,4-dimethyl-2-phenyl-2-oxazoline
19312-06-2 4,4-dimethyl-2-phenyl-2-oxazoline
| 상품명칭 |
4,4-dimethyl-2-phenyl-2-oxazoline |
| 영문 이름 |
4,4-dimethyl-2-phenyl-2-oxazoline;4,4-dimethyl-2-phenyl-4,5-dihydro-1,3-oxazole |
| 분자식 |
C11H13NO |
| 분자량 |
175.227 |
| InChI |
InChI=1/C11H13NO/c1-11(2)8-13-10(12-11)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| cas번호 |
19312-06-2 |
| 분자 구조 |
|
| 밀도 |
1.04g/cm3 |
| 녹는 점 |
20-24℃ |
| 비등점 |
241.5°C at 760 mmHg |
| 굴절 지수 |
1.542 |
| 인화점 |
93.2°C |
| 증기압 |
0.0555mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
