ChemNet > CAS > 19337-97-4 trans-3-(3-pyridyl)acrylic acid
19337-97-4 trans-3-(3-pyridyl)acrylic acid
| 상품명칭 |
trans-3-(3-pyridyl)acrylic acid |
| 영문 이름 |
trans-3-(3-pyridyl)acrylic acid; 3-(3-Pyridine)acrylic acid; (E)-3-(3-pyridinyl)acrylic acid |
| 분자식 |
C8H7NO2 |
| 분자량 |
149.14 |
| InChI |
InChI=1/C8H7NO2/c10-8(11)4-3-7-2-1-5-9-6-7/h1-6H,(H,10,11)/b4-3+ |
| cas번호 |
19337-97-4 |
| 분자 구조 |
|
| 녹는 점 |
232-235℃ |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
