ChemNet > CAS > 19437-26-4 Di-2-pyridyl ketone
19437-26-4 Di-2-pyridyl ketone
| 상품명칭 |
Di-2-pyridyl ketone |
| 영문 이름 |
Di-2-pyridyl ketone; Dipyridylketone; Di(2-pyridyl)ketone; dipyridin-2-ylmethanone |
| 분자식 |
C11H8N2O |
| 분자량 |
184.194 |
| InChI |
InChI=1/C11H8N2O/c14-11(9-5-1-3-7-12-9)10-6-2-4-8-13-10/h1-8H |
| cas번호 |
19437-26-4 |
| EC번호 |
243-067-3 |
| 분자 구조 |
|
| 밀도 |
1.196g/cm3 |
| 녹는 점 |
52-55℃ |
| 비등점 |
343.5°C at 760 mmHg |
| 굴절 지수 |
1.593 |
| 인화점 |
165.7°C |
| 증기압 |
7.01E-05mmHg at 25°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
