195383-80-3 2-브로모-4,5-디메톡시신남산
| 상품명칭 |
2-브로모-4,5-디메톡시신남산 |
| 별명 |
(2E)-3-(2-브로모-4,5-디메톡시페닐)프로프-2-에노에이트 |
| 영문 이름 |
2-Bromo-4,5-dimethoxycinnamic acid;(2E)-3-(2-bromo-4,5-dimethoxyphenyl)prop-2-enoate |
| 분자식 |
C11H10BrO4 |
| 분자량 |
286.0992 |
| InChI |
InChI=1/C11H11BrO4/c1-15-9-5-7(3-4-11(13)14)8(12)6-10(9)16-2/h3-6H,1-2H3,(H,13,14)/p-1/b4-3+ |
| cas번호 |
195383-80-3 |
| 분자 구조 |
|
| 녹는 점 |
253-254℃ |
| 비등점 |
409.5°C at 760 mmHg |
| 인화점 |
201.4°C |
| 증기압 |
1.94E-07mmHg at 25°C |
| 위험성 표시 |
Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|