ChemNet > CAS > 19542-77-9 N-Acetyl-S-benzyl-L-cysteine
19542-77-9 N-Acetyl-S-benzyl-L-cysteine
| 상품명칭 |
N-Acetyl-S-benzyl-L-cysteine |
| 영문 이름 |
N-Acetyl-S-benzyl-L-cysteine; S-Benzyl-N-acetyl-L-cysteine; Benzylmercapturic acid; S-Benzylmercapturic acid; SBNAC; L-Cysteine, N-acetyl-S-(phenylmethyl)-; methyl N-acetyl-S-phenyl-L-cysteinate; (2R)-2-(acetylamino)-3-(benzylsulfanyl)propanoate |
| 분자식 |
C12H14NO3S |
| 분자량 |
252.31 |
| InChI |
InChI=1/C12H15NO3S/c1-9(14)13-11(12(15)16)8-17-7-10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3,(H,13,14)(H,15,16)/p-1/t11-/m0/s1 |
| cas번호 |
19542-77-9 |
| 분자 구조 |
|
| 녹는 점 |
139-143℃ |
| 비등점 |
506.2°C at 760 mmHg |
| 인화점 |
259.9°C |
| 증기압 |
4.55E-11mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
