1956-10-1 4-nitrophenyl caprylate

상품명칭	4-nitrophenyl caprylate
영문 이름	4-nitrophenyl caprylate; Caprylic acid 4-nitrophenyl ester~4-Nitrophenyl octanoate~Octanoic acid 4-nitrophenyl ester; 4-Nitrophenyl octanoate
분자식	C₁₄H₁₉NO₄
분자량	265.305
InChI	InChI=1/C14H19NO4/c1-2-3-4-5-6-7-14(16)19-13-10-8-12(9-11-13)15(17)18/h8-11H,2-7H2,1H3
cas번호	1956-10-1
분자 구조
밀도	1.115g/cm³
비등점	378.7°C at 760 mmHg
굴절 지수	1.516
인화점	149.1°C
증기압	6.16E-06mmHg at 25°C
위험성 표시
리스크 규칙
보안 규칙	S24/25:Avoid contact with skin and eyes.;