ChemNet > CAS > 19579-44-3 1-(2-Chlorophenyl)biguanide hydrochloride
19579-44-3 1-(2-Chlorophenyl)biguanide hydrochloride
| 상품명칭 |
1-(2-Chlorophenyl)biguanide hydrochloride |
| 영문 이름 |
1-(2-Chlorophenyl)biguanide hydrochloride; {[(2-chloroanilino)(imino)methyl]amino}methanimidamide hydrochloride; 2-(2-chlorophenyl)-1-(diaminomethylidene)guanidine; N-{(1E)-amino[(diaminomethylidene)ammonio]methylidene}-2-chloroanilinium |
| 분자식 |
C8H12ClN5 |
| 분자량 |
213.6663 |
| InChI |
InChI=1/C8H10ClN5/c9-5-3-1-2-4-6(5)13-8(12)14-7(10)11/h1-4H,(H6,10,11,12,13,14)/p+2 |
| cas번호 |
19579-44-3 |
| 분자 구조 |
|
| 녹는 점 |
231-234℃ |
| 비등점 |
431.9°C at 760 mmHg |
| 인화점 |
215°C |
| 증기압 |
1.15E-07mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
