ChemNet > CAS > 1958-93-6 2-fluoro-6-nitrobenzyl bromide
1958-93-6 2-fluoro-6-nitrobenzyl bromide
| 상품명칭 |
2-fluoro-6-nitrobenzyl bromide |
| 영문 이름 |
2-fluoro-6-nitrobenzyl bromide; 2-Bromomethyl-1-fluoro-3-nitrobenzene; 2-(Bromomethyl)-1-fluoro-3-nitrobenzene |
| 분자식 |
C7H5BrFNO2 |
| 분자량 |
234.0225 |
| InChI |
InChI=1/C7H5BrFNO2/c8-4-5-6(9)2-1-3-7(5)10(11)12/h1-3H,4H2 |
| cas번호 |
1958-93-6 |
| EC번호 |
217-801-8 |
| 분자 구조 |
|
| 밀도 |
1.733g/cm3 |
| 비등점 |
275.5°C at 760 mmHg |
| 굴절 지수 |
1.588 |
| 인화점 |
120.4°C |
| 증기압 |
0.00852mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
