ChemNet > CAS > 1968-40-7 Ethyl pent-4-enoate
1968-40-7 Ethyl pent-4-enoate
상품명칭 |
Ethyl pent-4-enoate |
영문 이름 |
Ethyl pent-4-enoate; Ethyl pent-4-enoate, (Ethyl allylacetate; Pent-4-enoic aci; Ethyl allylacetate; 4-Pentenoic acid ethyl ester; Ethyl 4-pentenoate |
분자식 |
C7H12O2 |
분자량 |
128.169 |
InChI |
InChI=1/C7H12O2/c1-3-5-6-7(8)9-4-2/h3H,1,4-6H2,2H3 |
cas번호 |
1968-40-7 |
EC번호 |
217-818-0 |
분자 구조 |
|
밀도 |
0.898g/cm3 |
비등점 |
122.8°C at 760 mmHg |
굴절 지수 |
1.418 |
인화점 |
33.7°C |
증기압 |
13.7mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|