ChemNet > CAS > 19819-98-8 2-Methylphenethyl alcohol
19819-98-8 2-Methylphenethyl alcohol
상품명칭 |
2-Methylphenethyl alcohol |
영문 이름 |
2-Methylphenethyl alcohol; 2-o-tolylethanol; 2-(2-Methylphenyl)ethanol |
분자식 |
C9H12O |
분자량 |
136.191 |
InChI |
InChI=1/C9H12O/c1-8-4-2-3-5-9(8)6-7-10/h2-5,10H,6-7H2,1H3 |
cas번호 |
19819-98-8 |
EC번호 |
243-349-6 |
분자 구조 |
|
밀도 |
1.001g/cm3 |
비등점 |
243.5°C at 760 mmHg |
굴절 지수 |
1.532 |
인화점 |
108.3°C |
증기압 |
0.0172mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|