ChemNet > CAS > 19879-84-6 1-thio-beta-D-glucose tetraacetate
19879-84-6 1-thio-beta-D-glucose tetraacetate
상품명칭 |
1-thio-beta-D-glucose tetraacetate |
영문 이름 |
1-thio-beta-D-glucose tetraacetate;1-Thio-beta-D-glucose 2,3,4,6-tetraacetate; 2,3,4,6-tetra-O-acetyl-1-thio-beta-D-glucopyranose; 2,3,4,6-tetra-O-acetyl-1-thiohexopyranose |
분자식 |
C14H20O9S |
분자량 |
364.3682 |
InChI |
InChI=1/C14H20O9S/c1-6(15)19-5-10-11(20-7(2)16)12(21-8(3)17)13(14(24)23-10)22-9(4)18/h10-14,24H,5H2,1-4H3 |
cas번호 |
19879-84-6 |
EC번호 |
243-392-0 |
분자 구조 |
|
밀도 |
1.31g/cm3 |
녹는 점 |
115-117℃ |
비등점 |
425.5°C at 760 mmHg |
굴절 지수 |
1.502 |
인화점 |
298°C |
증기압 |
1.9E-07mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|