20099-89-2 Cyanophenacylbromide
상품명칭 |
Cyanophenacylbromide |
영문 이름 |
Cyanophenacylbromide; 4-Cyanophenacyl bromide; 2-Bromo-4-cyanoacetophenone; 4-(2-Bromoacetyl)benzonitrile; 4-(bromoacetyl)benzonitrile; 2-Bromo-4'-cyanoacetophenone; 2-Bromo-4'-cyano acetophenone |
분자식 |
C10H7BrO |
분자량 |
223.066 |
InChI |
InChI=1/C10H7BrO/c1-2-8-3-5-9(6-4-8)10(12)7-11/h1,3-6H,7H2 |
cas번호 |
20099-89-2 |
분자 구조 |
|
녹는 점 |
92-96℃ |
굴절 지수 |
1.59 |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|