ChemNet > CAS > 2024-83-1 3,4-Dimethoxybenzonitrile
2024-83-1 3,4-Dimethoxybenzonitrile
| 상품명칭 |
3,4-Dimethoxybenzonitrile |
| 영문 이름 |
3,4-Dimethoxybenzonitrile; Veratronitrile; 3,4-Dimethoybenzonitrile |
| 분자식 |
C9H9NO2 |
| 분자량 |
163.1733 |
| InChI |
InChI=1/C9H9NO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,1-2H3 |
| cas번호 |
2024-83-1 |
| EC번호 |
217-969-2 |
| 분자 구조 |
|
| 밀도 |
1.12g/cm3 |
| 녹는 점 |
66-71℃ |
| 비등점 |
266.2°C at 760 mmHg |
| 굴절 지수 |
1.519 |
| 인화점 |
107.5°C |
| 증기압 |
0.00877mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|
