ChemNet > CAS > 20300-02-1 Thiophene-2-thiocarboxamide
20300-02-1 Thiophene-2-thiocarboxamide
상품명칭 |
Thiophene-2-thiocarboxamide |
영문 이름 |
Thiophene-2-thiocarboxamide; Thiophene-2-carbothioamide |
분자식 |
C5H5NS2 |
분자량 |
143.2299 |
InChI |
InChI=1/C5H5NS2/c6-5(7)4-2-1-3-8-4/h1-3H,(H2,6,7) |
cas번호 |
20300-02-1 |
분자 구조 |
|
밀도 |
1.357g/cm3 |
녹는 점 |
106℃ |
비등점 |
259.5°C at 760 mmHg |
굴절 지수 |
1.701 |
인화점 |
110.7°C |
증기압 |
0.0129mmHg at 25°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R25:Toxic if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|