2039-76-1 3-acetylphenanthrene
상품명칭 |
3-acetylphenanthrene |
영문 이름 |
3-acetylphenanthrene; methyl 3-phenanthryl ketone; 1-(phenanthren-3-yl)ethanone |
분자식 |
C16H12O |
분자량 |
220.2659 |
InChI |
InChI=1/C16H12O/c1-11(17)14-9-8-13-7-6-12-4-2-3-5-15(12)16(13)10-14/h2-10H,1H3 |
cas번호 |
2039-76-1 |
EC번호 |
218-020-5 |
분자 구조 |
|
밀도 |
1.164g/cm3 |
녹는 점 |
67-71℃ |
비등점 |
405.9°C at 760 mmHg |
굴절 지수 |
1.685 |
인화점 |
180.7°C |
증기압 |
8.47E-07mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|