ChemNet > CAS > 2049-67-4 diethyl glutaconate, mixture of cis and tra
2049-67-4 diethyl glutaconate, mixture of cis and tra
| 상품명칭 |
diethyl glutaconate, mixture of cis and tra |
| 영문 이름 |
diethyl glutaconate, mixture of cis and tra; Diethyl glutaconate,mixture of cis and trans; diethyl pent-2-enedioate; diethyl (2E)-pent-2-enedioate; diethyl (2Z)-pent-2-enedioate; 2-Pentenedioic acid,1,5-diethyl ester; Diethyl glutaconate |
| 분자식 |
C9H14O4 |
| 분자량 |
186.2051 |
| InChI |
InChI=1/C9H14O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h5-6H,3-4,7H2,1-2H3/b6-5- |
| cas번호 |
2049-67-4 |
| EC번호 |
218-069-2 |
| 분자 구조 |
|
| 밀도 |
1.048g/cm3 |
| 비등점 |
237°C at 760 mmHg |
| 굴절 지수 |
1.445 |
| 인화점 |
106.7°C |
| 증기압 |
0.0459mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
|
|
