2049-96-9 n-Amyl benzoate
상품명칭 |
n-Amyl benzoate |
영문 이름 |
n-Amyl benzoate; pentyl benzoate; n-Amyl benzoate, (Benzoic acid n-amyl ester); N-pentyl benzoate |
분자식 |
C12H16O2 |
분자량 |
192.2542 |
InChI |
InChI=1/C12H16O2/c1-2-3-7-10-14-12(13)11-8-5-4-6-9-11/h4-6,8-9H,2-3,7,10H2,1H3 |
cas번호 |
2049-96-9 |
EC번호 |
218-077-6 |
분자 구조 |
|
밀도 |
0.994g/cm3 |
비등점 |
268.8°C at 760 mmHg |
굴절 지수 |
1.496 |
인화점 |
113.2°C |
증기압 |
0.00752mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|