ChemNet > CAS > 2050-23-9 Diethyl suberate
2050-23-9 Diethyl suberate
| 상품명칭 |
Diethyl suberate |
| 영문 이름 |
Diethyl suberate; Diethyl suberate, (Diethyl octanedioate; Suberic acid d; 2050-23-9Diethyl suberate; Diethyl octanedioate~Suberic acid diethyl ester; Octanedioic acid diethyl ester~Suberic acid diethyl ester; diethyl octanedioate |
| 분자식 |
C12H22O4 |
| 분자량 |
230.3007 |
| InChI |
InChI=1/C12H22O4/c1-3-15-11(13)9-7-5-6-8-10-12(14)16-4-2/h3-10H2,1-2H3 |
| cas번호 |
2050-23-9 |
| EC번호 |
218-084-4 |
| 분자 구조 |
|
| 밀도 |
0.985g/cm3 |
| 녹는 점 |
5-284℃ |
| 비등점 |
282.6°C at 760 mmHg |
| 굴절 지수 |
1.436 |
| 인화점 |
123.3°C |
| 증기압 |
0.00332mmHg at 25°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
