2051-49-2 Hexanoic anhydride
상품명칭 |
Hexanoic anhydride |
영문 이름 |
Hexanoic anhydride; Caproic anhydride; Hexanoic Acid Anhydride; N-hexanoic anhydride |
분자식 |
C12H22O3 |
분자량 |
214.3013 |
InChI |
InChI=1/C12H22O3/c1-3-5-7-9-11(13)15-12(14)10-8-6-4-2/h3-10H2,1-2H3 |
cas번호 |
2051-49-2 |
EC번호 |
218-121-4 |
분자 구조 |
|
밀도 |
0.943g/cm3 |
녹는 점 |
-40℃ |
비등점 |
247°C at 760 mmHg |
굴절 지수 |
1.436 |
인화점 |
116.6°C |
증기압 |
0.0263mmHg at 25°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|