2058-74-4 1-Methylisatin
상품명칭 |
1-Methylisatin |
영문 이름 |
1-Methylisatin; Methylisatintech; 1-methyl-2,3-dihydroindole-2,3-dione; N-Methylsatin; 1-Methyl-2,3-indolinedione; 1-methyl-1H-indole-2,3-dione; 1-Methylindoline-2,3-Dione |
분자식 |
C9H7NO2 |
분자량 |
161.1574 |
InChI |
InChI=1/C9H7NO2/c1-10-7-5-3-2-4-6(7)8(11)9(10)12/h2-5H,1H3 |
cas번호 |
2058-74-4 |
EC번호 |
218-164-9 |
분자 구조 |
|
밀도 |
1.314g/cm3 |
녹는 점 |
129-133℃ |
비등점 |
294.3°C at 760 mmHg |
굴절 지수 |
1.607 |
인화점 |
137.4°C |
증기압 |
0.00164mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|