ChemNet > CAS > 207974-14-9 4-Bromo-2,5-difluorobenzenesulphonyl chloride
207974-14-9 4-Bromo-2,5-difluorobenzenesulphonyl chloride
| 상품명칭 |
4-Bromo-2,5-difluorobenzenesulphonyl chloride |
| 영문 이름 |
4-Bromo-2,5-difluorobenzenesulphonyl chloride; 4-bromo-2,5-difluorobenzenesulfonyl chloride; 3,4-dihydro-2H-chromen-2-ylmethanol; 1,3-difluoro-2-isothiocyanatobenzene |
| 분자식 |
C7H3F2NS |
| 분자량 |
171.1672 |
| InChI |
InChI=1/C7H3F2NS/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
| cas번호 |
207974-14-9 |
| 분자 구조 |
|
| 밀도 |
1.26g/cm3 |
| 녹는 점 |
37℃ |
| 비등점 |
221.6°C at 760 mmHg |
| 굴절 지수 |
1.536 |
| 인화점 |
87.8°C |
| 증기압 |
0.158mmHg at 25°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
