ChemNet > CAS > 208399-66-0 (4-Methoxy-2-methylphenyl)boronic acid
208399-66-0 (4-Methoxy-2-methylphenyl)boronic acid
상품명칭 |
(4-Methoxy-2-methylphenyl)boronic acid |
영문 이름 |
(4-Methoxy-2-methylphenyl)boronic acid; 4-Methoxy-2-methylphenylboronic acid; 4-Methoxy-2-methylbenzeneboronic acid |
분자식 |
C8H11BO3 |
분자량 |
165.9821 |
InChI |
InChI=1/C8H11BO3/c1-6-5-7(12-2)3-4-8(6)9(10)11/h3-5,10-11H,1-2H3 |
cas번호 |
208399-66-0 |
분자 구조 |
|
밀도 |
1.14g/cm3 |
비등점 |
327.1°C at 760 mmHg |
굴절 지수 |
1.52 |
인화점 |
151.6°C |
증기압 |
8.4E-05mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|