20905-35-5 Trimethylene borate
상품명칭 |
Trimethylene borate |
영문 이름 |
Trimethylene borate; Boric acid cyclic ester with 1,3-propanediol; 2,2-[Propane-1,3-diylbis-(oxy)]-bis-1,3,2-dioxaborinane |
분자식 |
C9H18B2O6 |
분자량 |
243.8576 |
InChI |
InChI=1/C9H18B2O6/c1-4-12-10(13-5-1)16-8-3-9-17-11-14-6-2-7-15-11/h1-9H2 |
cas번호 |
20905-35-5 |
EC번호 |
244-109-3 |
분자 구조 |
|
밀도 |
1.1g/cm3 |
비등점 |
239.9°C at 760 mmHg |
굴절 지수 |
1.428 |
인화점 |
98.9°C |
증기압 |
0.0605mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|