ChemNet > CAS > 2096-86-8 4-Methylphenylacetone
2096-86-8 4-Methylphenylacetone
상품명칭 |
4-Methylphenylacetone |
영문 이름 |
4-Methylphenylacetone; 1-(4-methylphenyl)propan-2-one |
분자식 |
C10H12O |
분자량 |
148.2017 |
InChI |
InChI=1/C10H12O/c1-8-3-5-10(6-4-8)7-9(2)11/h3-6H,7H2,1-2H3 |
cas번호 |
2096-86-8 |
분자 구조 |
|
밀도 |
0.974g/cm3 |
비등점 |
223.1°C at 760 mmHg |
굴절 지수 |
1.507 |
인화점 |
97.1°C |
증기압 |
0.0982mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|