20972-36-5 trans-3-(4-methylbenzoyl)acrylic acid

상품명칭	trans-3-(4-methylbenzoyl)acrylic acid
영문 이름	trans-3-(4-methylbenzoyl)acrylic acid; 3-(4-Methylbenzoyl)acrylic acid; (2E)-4-(4-methylphenyl)-4-oxobut-2-enoic acid
분자식	C₁₁H₁₀O₃
분자량	190.1953
InChI	InChI=1/C11H10O3/c1-8-2-4-9(5-3-8)10(12)6-7-11(13)14/h2-7H,1H3,(H,13,14)/b7-6+
cas번호	20972-36-5
분자 구조
밀도	1.2g/cm³
녹는 점	138-140℃
비등점	361.8°C at 760 mmHg
굴절 지수	1.569
인화점	186.8°C
증기압	7.24E-06mmHg at 25°C
위험성 표시
리스크 규칙	R36/37/38:Irritating to eyes, respiratory system and skin.;
보안 규칙	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;